What are the properties and uses of linoleic acid? Introduction to linoleic acid
[Alias]Octadeca-9,12-diene, cis-octadeca-9,12-diene Acid, dense acid ［Molecular Formula］C18H32O2 ［Structural Formula］CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH [Properties] Linoleic acid is an unsaturated highe…
[Bite Chemical] What are the characteristics of linoleic acid in oils and fats?
Grease is the general term for oil and fat. Generally, what is liquid at room temperature is called oil, and what is solid is called fat. The source of fat can be animals or plants. Animal fats are ge…
Chinese